C20H24N2O5 — CID 145438051
N-cyclopropyl-2-oxo-2-[(8E)-13-oxo-3,6-dioxa-12-azabicyclo[12.4.0]octadeca-1(18),8,14,16-tetraen-11-yl]acetamide (PubChem CID 145438051) has the molecular formula C20H24N2O5 and a molecular weight of 372.42 g/mol. Its IUPAC name is N-cyclopropyl-2-oxo-2-[(8E)-13-oxo-3,6-dioxa-12-azabicyclo[12.4.0]octadeca-1(18),8,14,16-tetraen-11-yl]acetamide.
| Compound Name | N-cyclopropyl-2-oxo-2-[(8E)-13-oxo-3,6-dioxa-12-azabicyclo[12.4.0]octadeca-1(18),8,14,16-tetraen-11-yl]acetamide |
|---|---|
| PubChem CID | 145438051 |
| Molecular Formula | C20H24N2O5 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | N-cyclopropyl-2-oxo-2-[(8E)-13-oxo-3,6-dioxa-12-azabicyclo[12.4.0]octadeca-1(18),8,14,16-tetraen-11-yl]acetamide |
| SMILES | O=C(NC1CC1)C(=O)C1C/C=C/COCCOCc2ccccc2C(=O)N1 |
| InChI | InChI=1S/C20H24N2O5/c23-18(20(25)21-15-8-9-15)17-7-3-4-10-26-11-12-27-13-14-5-1-2-6-16(14)19(24)22-17/h1-6,15,17H,7-13H2,(H,21,25)(H,22,24)/b4-3+ |
| InChIKey | QPOLUVBAIDRECR-ONEGZZNKSA-N |
| XLogP | 1.13 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|