C16H19NO4 — CID 155649084
(11S)-13-oxo-3,6-dioxa-12-azabicyclo[12.4.0]octadeca-1(18),8,14,16-tetraene-11-carbaldehyde (PubChem CID 155649084) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is (11S)-13-oxo-3,6-dioxa-12-azabicyclo[12.4.0]octadeca-1(18),8,14,16-tetraene-11-carbaldehyde.
| Compound Name | (11S)-13-oxo-3,6-dioxa-12-azabicyclo[12.4.0]octadeca-1(18),8,14,16-tetraene-11-carbaldehyde |
|---|---|
| PubChem CID | 155649084 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | (11S)-13-oxo-3,6-dioxa-12-azabicyclo[12.4.0]octadeca-1(18),8,14,16-tetraene-11-carbaldehyde |
| SMILES | O=C[C@@H]1CC=CCOCCOCc2ccccc2C(=O)N1 |
| InChI | InChI=1S/C16H19NO4/c18-11-14-6-3-4-8-20-9-10-21-12-13-5-1-2-7-15(13)16(19)17-14/h1-5,7,11,14H,6,8-10,12H2,(H,17,19)/t14-/m0/s1 |
| InChIKey | GTYDJKKUXUAYLV-AWEZNQCLSA-N |
| XLogP | 1.48 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|