C15H17NO3 — CID 159631954
(9S)-11-oxo-2-oxa-10-azabicyclo[10.4.0]hexadeca-1(16),6,12,14-tetraene-9-carbaldehyde (PubChem CID 159631954) has the molecular formula C15H17NO3 and a molecular weight of 259.31 g/mol. Its IUPAC name is (9S)-11-oxo-2-oxa-10-azabicyclo[10.4.0]hexadeca-1(16),6,12,14-tetraene-9-carbaldehyde.
| Compound Name | (9S)-11-oxo-2-oxa-10-azabicyclo[10.4.0]hexadeca-1(16),6,12,14-tetraene-9-carbaldehyde |
|---|---|
| PubChem CID | 159631954 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | (9S)-11-oxo-2-oxa-10-azabicyclo[10.4.0]hexadeca-1(16),6,12,14-tetraene-9-carbaldehyde |
| SMILES | O=C[C@@H]1CC=CCCCOc2ccccc2C(=O)N1 |
| InChI | InChI=1S/C15H17NO3/c17-11-12-7-3-1-2-6-10-19-14-9-5-4-8-13(14)15(18)16-12/h1,3-5,8-9,11-12H,2,6-7,10H2,(H,16,18)/t12-/m0/s1 |
| InChIKey | NLLTVFPTWOHDKN-LBPRGKRZSA-N |
| XLogP | 2.10 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|