C23H25N3O3 — CID 155902604
(1R,13E,16S)-18-(pyridine-4-carbonyl)-10-oxa-2,18-diazatricyclo[14.4.0.04,9]icosa-4,6,8,13-tetraen-3-one (PubChem CID 155902604) has the molecular formula C23H25N3O3 and a molecular weight of 391.47 g/mol. Its IUPAC name is (1R,13E,16S)-18-(pyridine-4-carbonyl)-10-oxa-2,18-diazatricyclo[14.4.0.04,9]icosa-4,6,8,13-tetraen-3-one.
| Compound Name | (1R,13E,16S)-18-(pyridine-4-carbonyl)-10-oxa-2,18-diazatricyclo[14.4.0.04,9]icosa-4,6,8,13-tetraen-3-one |
|---|---|
| PubChem CID | 155902604 |
| Molecular Formula | C23H25N3O3 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | (1R,13E,16S)-18-(pyridine-4-carbonyl)-10-oxa-2,18-diazatricyclo[14.4.0.04,9]icosa-4,6,8,13-tetraen-3-one |
| SMILES | O=C1N[C@@H]2CCN(C(=O)c3ccncc3)C[C@@H]2C/C=C/CCOc2ccccc21 |
| InChI | InChI=1S/C23H25N3O3/c27-22-19-7-3-4-8-21(19)29-15-5-1-2-6-18-16-26(14-11-20(18)25-22)23(28)17-9-12-24-13-10-17/h1-4,7-10,12-13,18,20H,5-6,11,14-16H2,(H,25,27)/b2-1+/t18-,20+/m0/s1 |
| InChIKey | OAUPYAJLPHJTIP-STCBMFRASA-N |
| XLogP | 3.07 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|