C28H32N4O4 — CID 110153235
(4R,12Z)-1'-(pyridine-4-carbonyl)spiro[2-oxa-8,15-diazatricyclo[15.4.0.04,8]henicosa-1(21),12,17,19-tetraene-10,4'-piperidine]-9,16-dione (PubChem CID 110153235) has the molecular formula C28H32N4O4 and a molecular weight of 488.59 g/mol. Its IUPAC name is (4R,12Z)-1'-(pyridine-4-carbonyl)spiro[2-oxa-8,15-diazatricyclo[15.4.0.04,8]henicosa-1(21),12,17,19-tetraene-10,4'-piperidine]-9,16-dione.
| Compound Name | (4R,12Z)-1'-(pyridine-4-carbonyl)spiro[2-oxa-8,15-diazatricyclo[15.4.0.04,8]henicosa-1(21),12,17,19-tetraene-10,4'-piperidine]-9,16-dione |
|---|---|
| PubChem CID | 110153235 |
| Molecular Formula | C28H32N4O4 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.24 |
| IUPAC Name | (4R,12Z)-1'-(pyridine-4-carbonyl)spiro[2-oxa-8,15-diazatricyclo[15.4.0.04,8]henicosa-1(21),12,17,19-tetraene-10,4'-piperidine]-9,16-dione |
| SMILES | O=C1NC/C=C\CC2(CCN(C(=O)c3ccncc3)CC2)C(=O)N2CCC[C@@H]2COc2ccccc21 |
| InChI | InChI=1S/C28H32N4O4/c33-25-23-7-1-2-8-24(23)36-20-22-6-5-17-32(22)27(35)28(11-3-4-14-30-25)12-18-31(19-13-28)26(34)21-9-15-29-16-10-21/h1-4,7-10,15-16,22H,5-6,11-14,17-20H2,(H,30,33)/b4-3-/t22-/m1/s1 |
| InChIKey | HISAIJJZQCNHNT-LJBSOROUSA-N |
| XLogP | 3.06 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|