C27H34N4O5 — CID 133068490
1-[2-oxo-2-[(4S)-9-oxospiro[2-oxa-8-azatricyclo[13.4.0.04,8]nonadeca-1(19),15,17-triene-10,4'-piperidine]-1'-yl]ethyl]pyrimidine-2,4-dione (PubChem CID 133068490) has the molecular formula C27H34N4O5 and a molecular weight of 494.59 g/mol. Its IUPAC name is 1-[2-oxo-2-[(4S)-9-oxospiro[2-oxa-8-azatricyclo[13.4.0.04,8]nonadeca-1(19),15,17-triene-10,4'-piperidine]-1'-yl]ethyl]pyrimidine-2,4-dione.
| Compound Name | 1-[2-oxo-2-[(4S)-9-oxospiro[2-oxa-8-azatricyclo[13.4.0.04,8]nonadeca-1(19),15,17-triene-10,4'-piperidine]-1'-yl]ethyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 133068490 |
| Molecular Formula | C27H34N4O5 |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.25 |
| IUPAC Name | 1-[2-oxo-2-[(4S)-9-oxospiro[2-oxa-8-azatricyclo[13.4.0.04,8]nonadeca-1(19),15,17-triene-10,4'-piperidine]-1'-yl]ethyl]pyrimidine-2,4-dione |
| SMILES | O=C(Cn1ccc(=O)[nH]c1=O)N1CCC2(CCCCc3ccccc3OC[C@@H]3CCCN3C2=O)CC1 |
| InChI | InChI=1S/C27H34N4O5/c32-23-10-15-30(26(35)28-23)18-24(33)29-16-12-27(13-17-29)11-4-3-7-20-6-1-2-9-22(20)36-19-21-8-5-14-31(21)25(27)34/h1-2,6,9-10,15,21H,3-5,7-8,11-14,16-19H2,(H,28,32,35)/t21-/m0/s1 |
| InChIKey | HRXSABQRRCXIGD-NRFANRHFSA-N |
| XLogP | 1.94 |
| TPSA | 104.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |