C25H29N5O3 — CID 92620621
8-benzoyl-3-[(3S)-1-(pyridin-4-ylmethyl)piperidin-3-yl]-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 92620621) has the molecular formula C25H29N5O3 and a molecular weight of 447.54 g/mol. Its IUPAC name is 8-benzoyl-3-[(3S)-1-(pyridin-4-ylmethyl)piperidin-3-yl]-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-benzoyl-3-[(3S)-1-(pyridin-4-ylmethyl)piperidin-3-yl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 92620621 |
| Molecular Formula | C25H29N5O3 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | 8-benzoyl-3-[(3S)-1-(pyridin-4-ylmethyl)piperidin-3-yl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | O=C(c1ccccc1)N1CCC2(CC1)NC(=O)N([C@H]1CCCN(Cc3ccncc3)C1)C2=O |
| InChI | InChI=1S/C25H29N5O3/c31-22(20-5-2-1-3-6-20)29-15-10-25(11-16-29)23(32)30(24(33)27-25)21-7-4-14-28(18-21)17-19-8-12-26-13-9-19/h1-3,5-6,8-9,12-13,21H,4,7,10-11,14-18H2,(H,27,33)/t21-/m0/s1 |
| InChIKey | SSQMZOBEGIYUHL-NRFANRHFSA-N |
| XLogP | 2.27 |
| TPSA | 85.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|