C23H26N6O3 — CID 110084283
8-benzoyl-3-(1-pyrimidin-2-ylpiperidin-4-yl)-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 110084283) has the molecular formula C23H26N6O3 and a molecular weight of 434.50 g/mol. Its IUPAC name is 8-benzoyl-3-(1-pyrimidin-2-ylpiperidin-4-yl)-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-benzoyl-3-(1-pyrimidin-2-ylpiperidin-4-yl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 110084283 |
| Molecular Formula | C23H26N6O3 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | 8-benzoyl-3-(1-pyrimidin-2-ylpiperidin-4-yl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | O=C(c1ccccc1)N1CCC2(CC1)NC(=O)N(C1CCN(c3ncccn3)CC1)C2=O |
| InChI | InChI=1S/C23H26N6O3/c30-19(17-5-2-1-3-6-17)27-15-9-23(10-16-27)20(31)29(22(32)26-23)18-7-13-28(14-8-18)21-24-11-4-12-25-21/h1-6,11-12,18H,7-10,13-16H2,(H,26,32) |
| InChIKey | RGTWUYZPBCKEIU-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|