C24H28N6O3 — CID 110084297
8-benzyl-3-[1-(pyrazine-2-carbonyl)piperidin-3-yl]-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 110084297) has the molecular formula C24H28N6O3 and a molecular weight of 448.53 g/mol. Its IUPAC name is 8-benzyl-3-[1-(pyrazine-2-carbonyl)piperidin-3-yl]-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-benzyl-3-[1-(pyrazine-2-carbonyl)piperidin-3-yl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 110084297 |
| Molecular Formula | C24H28N6O3 |
| Molecular Weight | 448.53 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | 8-benzyl-3-[1-(pyrazine-2-carbonyl)piperidin-3-yl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | O=C(c1cnccn1)N1CCCC(N2C(=O)NC3(CCN(Cc4ccccc4)CC3)C2=O)C1 |
| InChI | InChI=1S/C24H28N6O3/c31-21(20-15-25-10-11-26-20)29-12-4-7-19(17-29)30-22(32)24(27-23(30)33)8-13-28(14-9-24)16-18-5-2-1-3-6-18/h1-3,5-6,10-11,15,19H,4,7-9,12-14,16-17H2,(H,27,33) |
| InChIKey | WBBSXGXCRFJRMQ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.53 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|