C23H31N5O4 — CID 110084309
N-[2-[3-(8-benzyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl)piperidin-1-yl]-2-oxoethyl]acetamide (PubChem CID 110084309) has the molecular formula C23H31N5O4 and a molecular weight of 441.53 g/mol. Its IUPAC name is N-[2-[3-(8-benzyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl)piperidin-1-yl]-2-oxoethyl]acetamide.
| Compound Name | N-[2-[3-(8-benzyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl)piperidin-1-yl]-2-oxoethyl]acetamide |
|---|---|
| PubChem CID | 110084309 |
| Molecular Formula | C23H31N5O4 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | N-[2-[3-(8-benzyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl)piperidin-1-yl]-2-oxoethyl]acetamide |
| SMILES | CC(=O)NCC(=O)N1CCCC(N2C(=O)NC3(CCN(Cc4ccccc4)CC3)C2=O)C1 |
| InChI | InChI=1S/C23H31N5O4/c1-17(29)24-14-20(30)27-11-5-8-19(16-27)28-21(31)23(25-22(28)32)9-12-26(13-10-23)15-18-6-3-2-4-7-18/h2-4,6-7,19H,5,8-16H2,1H3,(H,24,29)(H,25,32) |
| InChIKey | BMWVROAAFJLFOJ-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|