C26H30N4O3 — CID 110075843
3-(1-benzoylpiperidin-3-yl)-8-benzyl-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 110075843) has the molecular formula C26H30N4O3 and a molecular weight of 446.55 g/mol. Its IUPAC name is 3-(1-benzoylpiperidin-3-yl)-8-benzyl-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-(1-benzoylpiperidin-3-yl)-8-benzyl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 110075843 |
| Molecular Formula | C26H30N4O3 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | 3-(1-benzoylpiperidin-3-yl)-8-benzyl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | O=C(c1ccccc1)N1CCCC(N2C(=O)NC3(CCN(Cc4ccccc4)CC3)C2=O)C1 |
| InChI | InChI=1S/C26H30N4O3/c31-23(21-10-5-2-6-11-21)29-15-7-12-22(19-29)30-24(32)26(27-25(30)33)13-16-28(17-14-26)18-20-8-3-1-4-9-20/h1-6,8-11,22H,7,12-19H2,(H,27,33) |
| InChIKey | IONVZXCBZQIJIH-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|