C22H29FN4O3 — CID 110084338
8-ethyl-3-[1-[2-(3-fluorophenyl)acetyl]piperidin-3-yl]-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 110084338) has the molecular formula C22H29FN4O3 and a molecular weight of 416.50 g/mol. Its IUPAC name is 8-ethyl-3-[1-[2-(3-fluorophenyl)acetyl]piperidin-3-yl]-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-ethyl-3-[1-[2-(3-fluorophenyl)acetyl]piperidin-3-yl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 110084338 |
| Molecular Formula | C22H29FN4O3 |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | 8-ethyl-3-[1-[2-(3-fluorophenyl)acetyl]piperidin-3-yl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | CCN1CCC2(CC1)NC(=O)N(C1CCCN(C(=O)Cc3cccc(F)c3)C1)C2=O |
| InChI | InChI=1S/C22H29FN4O3/c1-2-25-11-8-22(9-12-25)20(29)27(21(30)24-22)18-7-4-10-26(15-18)19(28)14-16-5-3-6-17(23)13-16/h3,5-6,13,18H,2,4,7-12,14-15H2,1H3,(H,24,30) |
| InChIKey | OCHZTKKNYMRJGZ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|