C23H30N4O5 — CID 92620594
3-[(3R)-1-(2-phenoxyacetyl)piperidin-3-yl]-8-propanoyl-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 92620594) has the molecular formula C23H30N4O5 and a molecular weight of 442.52 g/mol. Its IUPAC name is 3-[(3R)-1-(2-phenoxyacetyl)piperidin-3-yl]-8-propanoyl-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[(3R)-1-(2-phenoxyacetyl)piperidin-3-yl]-8-propanoyl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 92620594 |
| Molecular Formula | C23H30N4O5 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | 3-[(3R)-1-(2-phenoxyacetyl)piperidin-3-yl]-8-propanoyl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | CCC(=O)N1CCC2(CC1)NC(=O)N([C@@H]1CCCN(C(=O)COc3ccccc3)C1)C2=O |
| InChI | InChI=1S/C23H30N4O5/c1-2-19(28)25-13-10-23(11-14-25)21(30)27(22(31)24-23)17-7-6-12-26(15-17)20(29)16-32-18-8-4-3-5-9-18/h3-5,8-9,17H,2,6-7,10-16H2,1H3,(H,24,31)/t17-/m1/s1 |
| InChIKey | DMELUWWZQNTGSW-QGZVFWFLSA-N |
| XLogP | 1.38 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|