C22H31N3O3 — CID 110063243
(9E)-1'-propan-2-ylspiro[2-oxa-5,12-diazabicyclo[12.4.0]octadeca-1(18),9,14,16-tetraene-7,4'-piperidine]-6,13-dione (PubChem CID 110063243) has the molecular formula C22H31N3O3 and a molecular weight of 385.51 g/mol. Its IUPAC name is (9E)-1'-propan-2-ylspiro[2-oxa-5,12-diazabicyclo[12.4.0]octadeca-1(18),9,14,16-tetraene-7,4'-piperidine]-6,13-dione.
| Compound Name | (9E)-1'-propan-2-ylspiro[2-oxa-5,12-diazabicyclo[12.4.0]octadeca-1(18),9,14,16-tetraene-7,4'-piperidine]-6,13-dione |
|---|---|
| PubChem CID | 110063243 |
| Molecular Formula | C22H31N3O3 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | (9E)-1'-propan-2-ylspiro[2-oxa-5,12-diazabicyclo[12.4.0]octadeca-1(18),9,14,16-tetraene-7,4'-piperidine]-6,13-dione |
| SMILES | CC(C)N1CCC2(C/C=C/CNC(=O)c3ccccc3OCCNC2=O)CC1 |
| InChI | InChI=1S/C22H31N3O3/c1-17(2)25-14-10-22(11-15-25)9-5-6-12-23-20(26)18-7-3-4-8-19(18)28-16-13-24-21(22)27/h3-8,17H,9-16H2,1-2H3,(H,23,26)(H,24,27)/b6-5+ |
| InChIKey | FTPKVQIMLAQNER-AATRIKPKSA-N |
| XLogP | 2.36 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|