C26H32FN3O3 — CID 133073290
1'-[(2-fluorophenyl)methyl]spiro[2-oxa-5,12-diazabicyclo[12.4.0]octadeca-1(18),14,16-triene-7,4'-piperidine]-6,13-dione (PubChem CID 133073290) has the molecular formula C26H32FN3O3 and a molecular weight of 453.56 g/mol. Its IUPAC name is 1'-[(2-fluorophenyl)methyl]spiro[2-oxa-5,12-diazabicyclo[12.4.0]octadeca-1(18),14,16-triene-7,4'-piperidine]-6,13-dione.
| Compound Name | 1'-[(2-fluorophenyl)methyl]spiro[2-oxa-5,12-diazabicyclo[12.4.0]octadeca-1(18),14,16-triene-7,4'-piperidine]-6,13-dione |
|---|---|
| PubChem CID | 133073290 |
| Molecular Formula | C26H32FN3O3 |
| Molecular Weight | 453.56 g/mol |
| Exact Mass | 453.24 |
| IUPAC Name | 1'-[(2-fluorophenyl)methyl]spiro[2-oxa-5,12-diazabicyclo[12.4.0]octadeca-1(18),14,16-triene-7,4'-piperidine]-6,13-dione |
| SMILES | O=C1NCCCCC2(CCN(Cc3ccccc3F)CC2)C(=O)NCCOc2ccccc21 |
| InChI | InChI=1S/C26H32FN3O3/c27-22-9-3-1-7-20(22)19-30-16-12-26(13-17-30)11-5-6-14-28-24(31)21-8-2-4-10-23(21)33-18-15-29-25(26)32/h1-4,7-10H,5-6,11-19H2,(H,28,31)(H,29,32) |
| InChIKey | FPYZFKMUQKURHY-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.56 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |