C30H43N5O5 — CID 110074182
(7E)-1'-[2-(azepan-1-yl)-2-oxoethyl]spiro[2-oxa-5,12,16-triazabicyclo[16.4.0]docosa-1(22),7,18,20-tetraene-10,4'-piperidine]-6,11,17-trione (PubChem CID 110074182) has the molecular formula C30H43N5O5 and a molecular weight of 553.70 g/mol. Its IUPAC name is (7E)-1'-[2-(azepan-1-yl)-2-oxoethyl]spiro[2-oxa-5,12,16-triazabicyclo[16.4.0]docosa-1(22),7,18,20-tetraene-10,4'-piperidine]-6,11,17-trione.
| Compound Name | (7E)-1'-[2-(azepan-1-yl)-2-oxoethyl]spiro[2-oxa-5,12,16-triazabicyclo[16.4.0]docosa-1(22),7,18,20-tetraene-10,4'-piperidine]-6,11,17-trione |
|---|---|
| PubChem CID | 110074182 |
| Molecular Formula | C30H43N5O5 |
| Molecular Weight | 553.70 g/mol |
| Exact Mass | 553.33 |
| IUPAC Name | (7E)-1'-[2-(azepan-1-yl)-2-oxoethyl]spiro[2-oxa-5,12,16-triazabicyclo[16.4.0]docosa-1(22),7,18,20-tetraene-10,4'-piperidine]-6,11,17-trione |
| SMILES | O=C1/C=C/CC2(CCN(CC(=O)N3CCCCCC3)CC2)C(=O)NCCCNC(=O)c2ccccc2OCCN1 |
| InChI | InChI=1S/C30H43N5O5/c36-26-11-7-12-30(13-20-34(21-14-30)23-27(37)35-18-5-1-2-6-19-35)29(39)33-16-8-15-32-28(38)24-9-3-4-10-25(24)40-22-17-31-26/h3-4,7,9-11H,1-2,5-6,8,12-23H2,(H,31,36)(H,32,38)(H,33,39)/b11-7+ |
| InChIKey | HEVOSKAUFACTHB-YRNVUSSQSA-N |
| XLogP | 1.86 |
| TPSA | 120.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.70 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |