C24H31N5O3 — CID 155901320
(9E)-1'-[(1-methylimidazol-2-yl)methyl]spiro[2-oxa-5,12-diazabicyclo[12.4.0]octadeca-1(18),9,14,16-tetraene-7,4'-piperidine]-6,13-dione (PubChem CID 155901320) has the molecular formula C24H31N5O3 and a molecular weight of 437.54 g/mol. Its IUPAC name is (9E)-1'-[(1-methylimidazol-2-yl)methyl]spiro[2-oxa-5,12-diazabicyclo[12.4.0]octadeca-1(18),9,14,16-tetraene-7,4'-piperidine]-6,13-dione.
| Compound Name | (9E)-1'-[(1-methylimidazol-2-yl)methyl]spiro[2-oxa-5,12-diazabicyclo[12.4.0]octadeca-1(18),9,14,16-tetraene-7,4'-piperidine]-6,13-dione |
|---|---|
| PubChem CID | 155901320 |
| Molecular Formula | C24H31N5O3 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.24 |
| IUPAC Name | (9E)-1'-[(1-methylimidazol-2-yl)methyl]spiro[2-oxa-5,12-diazabicyclo[12.4.0]octadeca-1(18),9,14,16-tetraene-7,4'-piperidine]-6,13-dione |
| SMILES | Cn1ccnc1CN1CCC2(C/C=C/CNC(=O)c3ccccc3OCCNC2=O)CC1 |
| InChI | InChI=1S/C24H31N5O3/c1-28-16-12-25-21(28)18-29-14-9-24(10-15-29)8-4-5-11-26-22(30)19-6-2-3-7-20(19)32-17-13-27-23(24)31/h2-7,12,16H,8-11,13-15,17-18H2,1H3,(H,26,30)(H,27,31)/b5-4+ |
| InChIKey | PQNLICDNJWWKAD-SNAWJCMRSA-N |
| XLogP | 1.89 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|