C23H28N4O3S — CID 124950477
(4E,7S)-1'-(1,3-thiazol-2-ylmethyl)spiro[2-oxa-9,12-diazabicyclo[12.4.0]octadeca-1(18),4,14,16-tetraene-7,3'-piperidine]-8,13-dione (PubChem CID 124950477) has the molecular formula C23H28N4O3S and a molecular weight of 440.57 g/mol. Its IUPAC name is (4E,7S)-1'-(1,3-thiazol-2-ylmethyl)spiro[2-oxa-9,12-diazabicyclo[12.4.0]octadeca-1(18),4,14,16-tetraene-7,3'-piperidine]-8,13-dione.
| Compound Name | (4E,7S)-1'-(1,3-thiazol-2-ylmethyl)spiro[2-oxa-9,12-diazabicyclo[12.4.0]octadeca-1(18),4,14,16-tetraene-7,3'-piperidine]-8,13-dione |
|---|---|
| PubChem CID | 124950477 |
| Molecular Formula | C23H28N4O3S |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | (4E,7S)-1'-(1,3-thiazol-2-ylmethyl)spiro[2-oxa-9,12-diazabicyclo[12.4.0]octadeca-1(18),4,14,16-tetraene-7,3'-piperidine]-8,13-dione |
| SMILES | O=C1NCCNC(=O)[C@]2(C/C=C/COc3ccccc31)CCCN(Cc1nccs1)C2 |
| InChI | InChI=1S/C23H28N4O3S/c28-21-18-6-1-2-7-19(18)30-14-4-3-8-23(22(29)26-11-10-25-21)9-5-13-27(17-23)16-20-24-12-15-31-20/h1-4,6-7,12,15H,5,8-11,13-14,16-17H2,(H,25,28)(H,26,29)/b4-3+/t23-/m1/s1 |
| InChIKey | DCAUMMKYRLIVAN-OSFWOZTASA-N |
| XLogP | 2.61 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|