C18H20N2O2S — CID 164693461
1'-(1,3-thiazol-2-ylmethyl)spiro[3H-chromene-2,4'-azepane]-4-one (PubChem CID 164693461) has the molecular formula C18H20N2O2S and a molecular weight of 328.44 g/mol. Its IUPAC name is 1'-(1,3-thiazol-2-ylmethyl)spiro[3H-chromene-2,4'-azepane]-4-one.
| Compound Name | 1'-(1,3-thiazol-2-ylmethyl)spiro[3H-chromene-2,4'-azepane]-4-one |
|---|---|
| PubChem CID | 164693461 |
| Molecular Formula | C18H20N2O2S |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 1'-(1,3-thiazol-2-ylmethyl)spiro[3H-chromene-2,4'-azepane]-4-one |
| SMILES | O=C1CC2(CCCN(Cc3nccs3)CC2)Oc2ccccc21 |
| InChI | InChI=1S/C18H20N2O2S/c21-15-12-18(22-16-5-2-1-4-14(15)16)6-3-9-20(10-7-18)13-17-19-8-11-23-17/h1-2,4-5,8,11H,3,6-7,9-10,12-13H2 |
| InChIKey | CIVJKYFNLVGCRL-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |