C17H21N3O4 — CID 164695148
[2-oxo-2-(4-oxospiro[3H-chromene-2,4'-azepane]-1'-yl)ethyl]urea (PubChem CID 164695148) has the molecular formula C17H21N3O4 and a molecular weight of 331.37 g/mol. Its IUPAC name is [2-oxo-2-(4-oxospiro[3H-chromene-2,4'-azepane]-1'-yl)ethyl]urea.
| Compound Name | [2-oxo-2-(4-oxospiro[3H-chromene-2,4'-azepane]-1'-yl)ethyl]urea |
|---|---|
| PubChem CID | 164695148 |
| Molecular Formula | C17H21N3O4 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | [2-oxo-2-(4-oxospiro[3H-chromene-2,4'-azepane]-1'-yl)ethyl]urea |
| SMILES | NC(=O)NCC(=O)N1CCCC2(CC1)CC(=O)c1ccccc1O2 |
| InChI | InChI=1S/C17H21N3O4/c18-16(23)19-11-15(22)20-8-3-6-17(7-9-20)10-13(21)12-4-1-2-5-14(12)24-17/h1-2,4-5H,3,6-11H2,(H3,18,19,23) |
| InChIKey | YLBJKBFGYINQFF-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |