C24H28N2O3 — CID 164690880
1'-(5-pyridin-3-ylpentanoyl)spiro[3H-chromene-2,4'-azepane]-4-one (PubChem CID 164690880) has the molecular formula C24H28N2O3 and a molecular weight of 392.50 g/mol. Its IUPAC name is 1'-(5-pyridin-3-ylpentanoyl)spiro[3H-chromene-2,4'-azepane]-4-one.
| Compound Name | 1'-(5-pyridin-3-ylpentanoyl)spiro[3H-chromene-2,4'-azepane]-4-one |
|---|---|
| PubChem CID | 164690880 |
| Molecular Formula | C24H28N2O3 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | 1'-(5-pyridin-3-ylpentanoyl)spiro[3H-chromene-2,4'-azepane]-4-one |
| SMILES | O=C1CC2(CCCN(C(=O)CCCCc3cccnc3)CC2)Oc2ccccc21 |
| InChI | InChI=1S/C24H28N2O3/c27-21-17-24(29-22-10-3-2-9-20(21)22)12-6-15-26(16-13-24)23(28)11-4-1-7-19-8-5-14-25-18-19/h2-3,5,8-10,14,18H,1,4,6-7,11-13,15-17H2 |
| InChIKey | MSRZVDDFAQKQJY-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|