C23H25NO4 — CID 164691259
1'-[2-(3-methoxyphenyl)acetyl]spiro[3H-chromene-2,4'-azepane]-4-one (PubChem CID 164691259) has the molecular formula C23H25NO4 and a molecular weight of 379.46 g/mol. Its IUPAC name is 1'-[2-(3-methoxyphenyl)acetyl]spiro[3H-chromene-2,4'-azepane]-4-one.
| Compound Name | 1'-[2-(3-methoxyphenyl)acetyl]spiro[3H-chromene-2,4'-azepane]-4-one |
|---|---|
| PubChem CID | 164691259 |
| Molecular Formula | C23H25NO4 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | 1'-[2-(3-methoxyphenyl)acetyl]spiro[3H-chromene-2,4'-azepane]-4-one |
| SMILES | COc1cccc(CC(=O)N2CCCC3(CC2)CC(=O)c2ccccc2O3)c1 |
| InChI | InChI=1S/C23H25NO4/c1-27-18-7-4-6-17(14-18)15-22(26)24-12-5-10-23(11-13-24)16-20(25)19-8-2-3-9-21(19)28-23/h2-4,6-9,14H,5,10-13,15-16H2,1H3 |
| InChIKey | HAWOCGLGYRUVKX-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |