C21H24N2O6 — CID 166598569
formic acid;1'-[2-(3-methyl-1,2-oxazol-5-yl)acetyl]spiro[3H-chromene-2,4'-azepane]-4-one (PubChem CID 166598569) has the molecular formula C21H24N2O6 and a molecular weight of 400.43 g/mol. Its IUPAC name is formic acid;1'-[2-(3-methyl-1,2-oxazol-5-yl)acetyl]spiro[3H-chromene-2,4'-azepane]-4-one.
| Compound Name | formic acid;1'-[2-(3-methyl-1,2-oxazol-5-yl)acetyl]spiro[3H-chromene-2,4'-azepane]-4-one |
|---|---|
| PubChem CID | 166598569 |
| Molecular Formula | C21H24N2O6 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | formic acid;1'-[2-(3-methyl-1,2-oxazol-5-yl)acetyl]spiro[3H-chromene-2,4'-azepane]-4-one |
| SMILES | Cc1cc(CC(=O)N2CCCC3(CC2)CC(=O)c2ccccc2O3)on1.O=CO |
| InChI | InChI=1S/C20H22N2O4.CH2O2/c1-14-11-15(26-21-14)12-19(24)22-9-4-7-20(8-10-22)13-17(23)16-5-2-3-6-18(16)25-20;2-1-3/h2-3,5-6,11H,4,7-10,12-13H2,1H3;1H,(H,2,3) |
| InChIKey | FZWCVZSDGBFZBV-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 109.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|