C16H19NO4 — CID 164694844
2-(4-oxospiro[3H-chromene-2,4'-azepane]-1'-yl)acetic acid (PubChem CID 164694844) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is 2-(4-oxospiro[3H-chromene-2,4'-azepane]-1'-yl)acetic acid.
| Compound Name | 2-(4-oxospiro[3H-chromene-2,4'-azepane]-1'-yl)acetic acid |
|---|---|
| PubChem CID | 164694844 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 2-(4-oxospiro[3H-chromene-2,4'-azepane]-1'-yl)acetic acid |
| SMILES | O=C(O)CN1CCCC2(CC1)CC(=O)c1ccccc1O2 |
| InChI | InChI=1S/C16H19NO4/c18-13-10-16(21-14-5-2-1-4-12(13)14)6-3-8-17(9-7-16)11-15(19)20/h1-2,4-5H,3,6-11H2,(H,19,20) |
| InChIKey | JWMBLUJIRMUIOF-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |