C22H25NO7 — CID 166599635
formic acid;methyl 5-[(4-oxospiro[3H-chromene-2,4'-azepane]-1'-yl)methyl]furan-2-carboxylate (PubChem CID 166599635) has the molecular formula C22H25NO7 and a molecular weight of 415.44 g/mol. Its IUPAC name is formic acid;methyl 5-[(4-oxospiro[3H-chromene-2,4'-azepane]-1'-yl)methyl]furan-2-carboxylate.
| Compound Name | formic acid;methyl 5-[(4-oxospiro[3H-chromene-2,4'-azepane]-1'-yl)methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 166599635 |
| Molecular Formula | C22H25NO7 |
| Molecular Weight | 415.44 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | formic acid;methyl 5-[(4-oxospiro[3H-chromene-2,4'-azepane]-1'-yl)methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CN2CCCC3(CC2)CC(=O)c2ccccc2O3)o1.O=CO |
| InChI | InChI=1S/C21H23NO5.CH2O2/c1-25-20(24)19-8-7-15(26-19)14-22-11-4-9-21(10-12-22)13-17(23)16-5-2-3-6-18(16)27-21;2-1-3/h2-3,5-8H,4,9-14H2,1H3;1H,(H,2,3) |
| InChIKey | CKGCFBGLAUKSPA-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 106.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.44 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|