C20H21ClN2O2 — CID 164694401
1'-[(5-chloro-2-pyridinyl)methyl]spiro[3H-chromene-2,4'-azepane]-4-one (PubChem CID 164694401) has the molecular formula C20H21ClN2O2 and a molecular weight of 356.85 g/mol. Its IUPAC name is 1'-[(5-chloro-2-pyridinyl)methyl]spiro[3H-chromene-2,4'-azepane]-4-one.
| Compound Name | 1'-[(5-chloro-2-pyridinyl)methyl]spiro[3H-chromene-2,4'-azepane]-4-one |
|---|---|
| PubChem CID | 164694401 |
| Molecular Formula | C20H21ClN2O2 |
| Molecular Weight | 356.85 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 1'-[(5-chloro-2-pyridinyl)methyl]spiro[3H-chromene-2,4'-azepane]-4-one |
| SMILES | O=C1CC2(CCCN(Cc3ccc(Cl)cn3)CC2)Oc2ccccc21 |
| InChI | InChI=1S/C20H21ClN2O2/c21-15-6-7-16(22-13-15)14-23-10-3-8-20(9-11-23)12-18(24)17-4-1-2-5-19(17)25-20/h1-2,4-7,13H,3,8-12,14H2 |
| InChIKey | UBDUELVLHVYRGV-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.85 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |