C19H16ClNO3 — CID 90585858
1'-(4-chlorobenzoyl)spiro[3H-chromene-2,3'-pyrrolidine]-4-one (PubChem CID 90585858) has the molecular formula C19H16ClNO3 and a molecular weight of 341.79 g/mol. Its IUPAC name is 1'-(4-chlorobenzoyl)spiro[3H-chromene-2,3'-pyrrolidine]-4-one.
| Compound Name | 1'-(4-chlorobenzoyl)spiro[3H-chromene-2,3'-pyrrolidine]-4-one |
|---|---|
| PubChem CID | 90585858 |
| Molecular Formula | C19H16ClNO3 |
| Molecular Weight | 341.79 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | 1'-(4-chlorobenzoyl)spiro[3H-chromene-2,3'-pyrrolidine]-4-one |
| SMILES | O=C1CC2(CCN(C(=O)c3ccc(Cl)cc3)C2)Oc2ccccc21 |
| InChI | InChI=1S/C19H16ClNO3/c20-14-7-5-13(6-8-14)18(23)21-10-9-19(12-21)11-16(22)15-3-1-2-4-17(15)24-19/h1-8H,9-12H2 |
| InChIKey | YXSMVEWGBPDKBU-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.79 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |