C19H23NO3 — CID 90585833
1'-(2-cyclopentylacetyl)spiro[3H-chromene-2,3'-pyrrolidine]-4-one (PubChem CID 90585833) has the molecular formula C19H23NO3 and a molecular weight of 313.40 g/mol. Its IUPAC name is 1'-(2-cyclopentylacetyl)spiro[3H-chromene-2,3'-pyrrolidine]-4-one.
| Compound Name | 1'-(2-cyclopentylacetyl)spiro[3H-chromene-2,3'-pyrrolidine]-4-one |
|---|---|
| PubChem CID | 90585833 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | 1'-(2-cyclopentylacetyl)spiro[3H-chromene-2,3'-pyrrolidine]-4-one |
| SMILES | O=C1CC2(CCN(C(=O)CC3CCCC3)C2)Oc2ccccc21 |
| InChI | InChI=1S/C19H23NO3/c21-16-12-19(23-17-8-4-3-7-15(16)17)9-10-20(13-19)18(22)11-14-5-1-2-6-14/h3-4,7-8,14H,1-2,5-6,9-13H2 |
| InChIKey | HLVAOTSAIGPRCE-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |