C23H26N2O3 — CID 164696517
N-benzyl-2-(4-oxospiro[3H-chromene-2,4'-azepane]-1'-yl)acetamide (PubChem CID 164696517) has the molecular formula C23H26N2O3 and a molecular weight of 378.47 g/mol. Its IUPAC name is N-benzyl-2-(4-oxospiro[3H-chromene-2,4'-azepane]-1'-yl)acetamide.
| Compound Name | N-benzyl-2-(4-oxospiro[3H-chromene-2,4'-azepane]-1'-yl)acetamide |
|---|---|
| PubChem CID | 164696517 |
| Molecular Formula | C23H26N2O3 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | N-benzyl-2-(4-oxospiro[3H-chromene-2,4'-azepane]-1'-yl)acetamide |
| SMILES | O=C(CN1CCCC2(CC1)CC(=O)c1ccccc1O2)NCc1ccccc1 |
| InChI | InChI=1S/C23H26N2O3/c26-20-15-23(28-21-10-5-4-9-19(20)21)11-6-13-25(14-12-23)17-22(27)24-16-18-7-2-1-3-8-18/h1-5,7-10H,6,11-17H2,(H,24,27) |
| InChIKey | PLLRTMZJTGVGTQ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |