C20H22N2O2 — CID 124849629
(2S)-1'-(3-pyridin-3-ylpropyl)spiro[3H-chromene-2,3'-pyrrolidine]-4-one (PubChem CID 124849629) has the molecular formula C20H22N2O2 and a molecular weight of 322.41 g/mol. Its IUPAC name is (2S)-1'-(3-pyridin-3-ylpropyl)spiro[3H-chromene-2,3'-pyrrolidine]-4-one.
| Compound Name | (2S)-1'-(3-pyridin-3-ylpropyl)spiro[3H-chromene-2,3'-pyrrolidine]-4-one |
|---|---|
| PubChem CID | 124849629 |
| Molecular Formula | C20H22N2O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | (2S)-1'-(3-pyridin-3-ylpropyl)spiro[3H-chromene-2,3'-pyrrolidine]-4-one |
| SMILES | O=C1C[C@]2(CCN(CCCc3cccnc3)C2)Oc2ccccc21 |
| InChI | InChI=1S/C20H22N2O2/c23-18-13-20(24-19-8-2-1-7-17(18)19)9-12-22(15-20)11-4-6-16-5-3-10-21-14-16/h1-3,5,7-8,10,14H,4,6,9,11-13,15H2/t20-/m0/s1 |
| InChIKey | PDJVROIBRINJRA-FQEVSTJZSA-N |
| XLogP | 3.12 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |