C26H29N3O4 — CID 110063336
(4E)-1'-benzoylspiro[2-oxa-9,12-diazabicyclo[12.4.0]octadeca-1(18),4,14,16-tetraene-7,3'-piperidine]-8,13-dione (PubChem CID 110063336) has the molecular formula C26H29N3O4 and a molecular weight of 447.54 g/mol. Its IUPAC name is (4E)-1'-benzoylspiro[2-oxa-9,12-diazabicyclo[12.4.0]octadeca-1(18),4,14,16-tetraene-7,3'-piperidine]-8,13-dione.
| Compound Name | (4E)-1'-benzoylspiro[2-oxa-9,12-diazabicyclo[12.4.0]octadeca-1(18),4,14,16-tetraene-7,3'-piperidine]-8,13-dione |
|---|---|
| PubChem CID | 110063336 |
| Molecular Formula | C26H29N3O4 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | (4E)-1'-benzoylspiro[2-oxa-9,12-diazabicyclo[12.4.0]octadeca-1(18),4,14,16-tetraene-7,3'-piperidine]-8,13-dione |
| SMILES | O=C1NCCNC(=O)C2(C/C=C/COc3ccccc31)CCCN(C(=O)c1ccccc1)C2 |
| InChI | InChI=1S/C26H29N3O4/c30-23-21-11-4-5-12-22(21)33-18-7-6-13-26(25(32)28-16-15-27-23)14-8-17-29(19-26)24(31)20-9-2-1-3-10-20/h1-7,9-12H,8,13-19H2,(H,27,30)(H,28,32)/b7-6+ |
| InChIKey | JGRDQTBPCCPLBC-VOTSOKGWSA-N |
| XLogP | 2.79 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|