C20H24F3N3O5 — CID 171145596
9-methylspiro[2-oxa-9,12-diazabicyclo[12.4.0]octadeca-1(18),4,14,16-tetraene-7,3'-azetidine]-8,13-dione;2,2,2-trifluoroacetic acid (PubChem CID 171145596) has the molecular formula C20H24F3N3O5 and a molecular weight of 443.42 g/mol. Its IUPAC name is 9-methylspiro[2-oxa-9,12-diazabicyclo[12.4.0]octadeca-1(18),4,14,16-tetraene-7,3'-azetidine]-8,13-dione;2,2,2-trifluoroacetic acid.
| Compound Name | 9-methylspiro[2-oxa-9,12-diazabicyclo[12.4.0]octadeca-1(18),4,14,16-tetraene-7,3'-azetidine]-8,13-dione;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 171145596 |
| Molecular Formula | C20H24F3N3O5 |
| Molecular Weight | 443.42 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | 9-methylspiro[2-oxa-9,12-diazabicyclo[12.4.0]octadeca-1(18),4,14,16-tetraene-7,3'-azetidine]-8,13-dione;2,2,2-trifluoroacetic acid |
| SMILES | CN1CCNC(=O)c2ccccc2OCC=CCC2(CNC2)C1=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H23N3O3.C2HF3O2/c1-21-10-9-20-16(22)14-6-2-3-7-15(14)24-11-5-4-8-18(17(21)23)12-19-13-18;3-2(4,5)1(6)7/h2-7,19H,8-13H2,1H3,(H,20,22);(H,6,7) |
| InChIKey | BSBCKVSLNZWYBQ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.42 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|