C31H39N3O5 — CID 133071803
tert-butyl (4E,10S)-10-benzyl-8,13-dioxospiro[2-oxa-9,12-diazabicyclo[12.4.0]octadeca-1(18),4,14,16-tetraene-7,4'-piperidine]-1'-carboxylate (PubChem CID 133071803) has the molecular formula C31H39N3O5 and a molecular weight of 533.67 g/mol. Its IUPAC name is tert-butyl (4E,10S)-10-benzyl-8,13-dioxospiro[2-oxa-9,12-diazabicyclo[12.4.0]octadeca-1(18),4,14,16-tetraene-7,4'-piperidine]-1'-carboxylate.
| Compound Name | tert-butyl (4E,10S)-10-benzyl-8,13-dioxospiro[2-oxa-9,12-diazabicyclo[12.4.0]octadeca-1(18),4,14,16-tetraene-7,4'-piperidine]-1'-carboxylate |
|---|---|
| PubChem CID | 133071803 |
| Molecular Formula | C31H39N3O5 |
| Molecular Weight | 533.67 g/mol |
| Exact Mass | 533.29 |
| IUPAC Name | tert-butyl (4E,10S)-10-benzyl-8,13-dioxospiro[2-oxa-9,12-diazabicyclo[12.4.0]octadeca-1(18),4,14,16-tetraene-7,4'-piperidine]-1'-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(C/C=C/COc3ccccc3C(=O)NC[C@H](Cc3ccccc3)NC2=O)CC1 |
| InChI | InChI=1S/C31H39N3O5/c1-30(2,3)39-29(37)34-18-16-31(17-19-34)15-9-10-20-38-26-14-8-7-13-25(26)27(35)32-22-24(33-28(31)36)21-23-11-5-4-6-12-23/h4-14,24H,15-22H2,1-3H3,(H,32,35)(H,33,36)/b10-9+/t24-/m0/s1 |
| InChIKey | ILKMAOTXUUXQOQ-GTCGAKFVSA-N |
| XLogP | 4.50 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.67 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|