C22H26F3N3O5 — CID 154879076
(1S,12Z)-spiro[10-oxa-2,17-diazatricyclo[15.3.1.04,9]henicosa-4,6,8,12-tetraene-15,3'-azetidine]-3,16-dione;2,2,2-trifluoroacetic acid (PubChem CID 154879076) has the molecular formula C22H26F3N3O5 and a molecular weight of 469.46 g/mol. Its IUPAC name is (1S,12Z)-spiro[10-oxa-2,17-diazatricyclo[15.3.1.04,9]henicosa-4,6,8,12-tetraene-15,3'-azetidine]-3,16-dione;2,2,2-trifluoroacetic acid.
| Compound Name | (1S,12Z)-spiro[10-oxa-2,17-diazatricyclo[15.3.1.04,9]henicosa-4,6,8,12-tetraene-15,3'-azetidine]-3,16-dione;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 154879076 |
| Molecular Formula | C22H26F3N3O5 |
| Molecular Weight | 469.46 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | (1S,12Z)-spiro[10-oxa-2,17-diazatricyclo[15.3.1.04,9]henicosa-4,6,8,12-tetraene-15,3'-azetidine]-3,16-dione;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C1N[C@H]2CCCN(C2)C(=O)C2(C/C=C\COc3ccccc31)CNC2 |
| InChI | InChI=1S/C20H25N3O3.C2HF3O2/c24-18-16-7-1-2-8-17(16)26-11-4-3-9-20(13-21-14-20)19(25)23-10-5-6-15(12-23)22-18;3-2(4,5)1(6)7/h1-4,7-8,15,21H,5-6,9-14H2,(H,22,24);(H,6,7)/b4-3-;/t15-;/m0./s1 |
| InChIKey | NVSKPGOMYWVVON-WSBQQBNDSA-N |
| XLogP | 1.97 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.46 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|