C29H38F3N3O6 — CID 167911784
CID 167911784 (PubChem CID 167911784) has the molecular formula C29H38F3N3O6 and a molecular weight of 581.63 g/mol.
| Compound Name | CID 167911784 |
|---|---|
| PubChem CID | 167911784 |
| Molecular Formula | C29H38F3N3O6 |
| Molecular Weight | 581.63 g/mol |
| Exact Mass | 581.27 |
| IUPAC Name | — |
| SMILES | O=C(O)C(F)(F)F.O=C1NCC2CN(CCC23CCOCC3)C(=O)C2(C/C=C/COc3ccccc31)CCCNC2 |
| InChI | InChI=1S/C27H37N3O4.C2HF3O2/c31-24-22-6-1-2-7-23(22)34-15-4-3-8-27(9-5-13-28-20-27)25(32)30-14-10-26(11-16-33-17-12-26)21(19-30)18-29-24;3-2(4,5)1(6)7/h1-4,6-7,21,28H,5,8-20H2,(H,29,31);(H,6,7)/b4-3+; |
| InChIKey | LSRWZAAMQKWKEO-BJILWQEISA-N |
| XLogP | 3.40 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.63 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|