C31H40N4O3 — CID 110075073
1'-[(1-ethyl-2-methylindol-3-yl)methyl]spiro[2-oxa-5,12-diazabicyclo[12.4.0]octadeca-1(18),14,16-triene-7,4'-piperidine]-6,13-dione (PubChem CID 110075073) has the molecular formula C31H40N4O3 and a molecular weight of 516.69 g/mol. Its IUPAC name is 1'-[(1-ethyl-2-methylindol-3-yl)methyl]spiro[2-oxa-5,12-diazabicyclo[12.4.0]octadeca-1(18),14,16-triene-7,4'-piperidine]-6,13-dione.
| Compound Name | 1'-[(1-ethyl-2-methylindol-3-yl)methyl]spiro[2-oxa-5,12-diazabicyclo[12.4.0]octadeca-1(18),14,16-triene-7,4'-piperidine]-6,13-dione |
|---|---|
| PubChem CID | 110075073 |
| Molecular Formula | C31H40N4O3 |
| Molecular Weight | 516.69 g/mol |
| Exact Mass | 516.31 |
| IUPAC Name | 1'-[(1-ethyl-2-methylindol-3-yl)methyl]spiro[2-oxa-5,12-diazabicyclo[12.4.0]octadeca-1(18),14,16-triene-7,4'-piperidine]-6,13-dione |
| SMILES | CCn1c(C)c(CN2CCC3(CCCCNC(=O)c4ccccc4OCCNC3=O)CC2)c2ccccc21 |
| InChI | InChI=1S/C31H40N4O3/c1-3-35-23(2)26(24-10-4-6-12-27(24)35)22-34-19-15-31(16-20-34)14-8-9-17-32-29(36)25-11-5-7-13-28(25)38-21-18-33-30(31)37/h4-7,10-13H,3,8-9,14-22H2,1-2H3,(H,32,36)(H,33,37) |
| InChIKey | DZOXCNPFXXFAJY-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.69 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|