C27H39N5O3 — CID 133067984
(4R)-1'-[(2-ethyl-5-methyl-1H-imidazol-4-yl)methyl]-4-methylspiro[2-oxa-5,12-diazabicyclo[12.4.0]octadeca-1(18),14,16-triene-7,4'-piperidine]-6,13-dione (PubChem CID 133067984) has the molecular formula C27H39N5O3 and a molecular weight of 481.64 g/mol. Its IUPAC name is (4R)-1'-[(2-ethyl-5-methyl-1H-imidazol-4-yl)methyl]-4-methylspiro[2-oxa-5,12-diazabicyclo[12.4.0]octadeca-1(18),14,16-triene-7,4'-piperidine]-6,13-dione.
| Compound Name | (4R)-1'-[(2-ethyl-5-methyl-1H-imidazol-4-yl)methyl]-4-methylspiro[2-oxa-5,12-diazabicyclo[12.4.0]octadeca-1(18),14,16-triene-7,4'-piperidine]-6,13-dione |
|---|---|
| PubChem CID | 133067984 |
| Molecular Formula | C27H39N5O3 |
| Molecular Weight | 481.64 g/mol |
| Exact Mass | 481.31 |
| IUPAC Name | (4R)-1'-[(2-ethyl-5-methyl-1H-imidazol-4-yl)methyl]-4-methylspiro[2-oxa-5,12-diazabicyclo[12.4.0]octadeca-1(18),14,16-triene-7,4'-piperidine]-6,13-dione |
| SMILES | CCc1nc(CN2CCC3(CCCCNC(=O)c4ccccc4OC[C@@H](C)NC3=O)CC2)c(C)[nH]1 |
| InChI | InChI=1S/C27H39N5O3/c1-4-24-30-20(3)22(31-24)17-32-15-12-27(13-16-32)11-7-8-14-28-25(33)21-9-5-6-10-23(21)35-18-19(2)29-26(27)34/h5-6,9-10,19H,4,7-8,11-18H2,1-3H3,(H,28,33)(H,29,34)(H,30,31)/t19-/m1/s1 |
| InChIKey | AWJGPECQWBATBL-LJQANCHMSA-N |
| XLogP | 3.36 |
| TPSA | 99.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.64 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |