C29H37FN4O4 — CID 110064732
(4R)-1'-[(2R)-2-amino-3-(3-fluorophenyl)propanoyl]-4-methylspiro[2-oxa-5,12-diazabicyclo[12.4.0]octadeca-1(18),14,16-triene-7,4'-piperidine]-6,13-dione (PubChem CID 110064732) has the molecular formula C29H37FN4O4 and a molecular weight of 524.64 g/mol. Its IUPAC name is (4R)-1'-[(2R)-2-amino-3-(3-fluorophenyl)propanoyl]-4-methylspiro[2-oxa-5,12-diazabicyclo[12.4.0]octadeca-1(18),14,16-triene-7,4'-piperidine]-6,13-dione.
| Compound Name | (4R)-1'-[(2R)-2-amino-3-(3-fluorophenyl)propanoyl]-4-methylspiro[2-oxa-5,12-diazabicyclo[12.4.0]octadeca-1(18),14,16-triene-7,4'-piperidine]-6,13-dione |
|---|---|
| PubChem CID | 110064732 |
| Molecular Formula | C29H37FN4O4 |
| Molecular Weight | 524.64 g/mol |
| Exact Mass | 524.28 |
| IUPAC Name | (4R)-1'-[(2R)-2-amino-3-(3-fluorophenyl)propanoyl]-4-methylspiro[2-oxa-5,12-diazabicyclo[12.4.0]octadeca-1(18),14,16-triene-7,4'-piperidine]-6,13-dione |
| SMILES | C[C@@H]1COc2ccccc2C(=O)NCCCCC2(CCN(C(=O)[C@H](N)Cc3cccc(F)c3)CC2)C(=O)N1 |
| InChI | InChI=1S/C29H37FN4O4/c1-20-19-38-25-10-3-2-9-23(25)26(35)32-14-5-4-11-29(28(37)33-20)12-15-34(16-13-29)27(36)24(31)18-21-7-6-8-22(30)17-21/h2-3,6-10,17,20,24H,4-5,11-16,18-19,31H2,1H3,(H,32,35)(H,33,37)/t20-,24-/m1/s1 |
| InChIKey | CHSIMTXJGABIBR-HYBUGGRVSA-N |
| XLogP | 2.80 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.64 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |