C33H44N4O5 — CID 110062793
(4R)-1'-(2-methoxy-5-piperidin-1-ylbenzoyl)-4-methylspiro[2-oxa-5,12-diazabicyclo[12.4.0]octadeca-1(18),14,16-triene-7,4'-piperidine]-6,13-dione (PubChem CID 110062793) has the molecular formula C33H44N4O5 and a molecular weight of 576.74 g/mol. Its IUPAC name is (4R)-1'-(2-methoxy-5-piperidin-1-ylbenzoyl)-4-methylspiro[2-oxa-5,12-diazabicyclo[12.4.0]octadeca-1(18),14,16-triene-7,4'-piperidine]-6,13-dione.
| Compound Name | (4R)-1'-(2-methoxy-5-piperidin-1-ylbenzoyl)-4-methylspiro[2-oxa-5,12-diazabicyclo[12.4.0]octadeca-1(18),14,16-triene-7,4'-piperidine]-6,13-dione |
|---|---|
| PubChem CID | 110062793 |
| Molecular Formula | C33H44N4O5 |
| Molecular Weight | 576.74 g/mol |
| Exact Mass | 576.33 |
| IUPAC Name | (4R)-1'-(2-methoxy-5-piperidin-1-ylbenzoyl)-4-methylspiro[2-oxa-5,12-diazabicyclo[12.4.0]octadeca-1(18),14,16-triene-7,4'-piperidine]-6,13-dione |
| SMILES | COc1ccc(N2CCCCC2)cc1C(=O)N1CCC2(CCCCNC(=O)c3ccccc3OC[C@@H](C)NC2=O)CC1 |
| InChI | InChI=1S/C33H44N4O5/c1-24-23-42-29-11-5-4-10-26(29)30(38)34-17-7-6-14-33(32(40)35-24)15-20-37(21-16-33)31(39)27-22-25(12-13-28(27)41-2)36-18-8-3-9-19-36/h4-5,10-13,22,24H,3,6-9,14-21,23H2,1-2H3,(H,34,38)(H,35,40)/t24-/m1/s1 |
| InChIKey | HTUVDDQXKMVCPT-XMMPIXPASA-N |
| XLogP | 4.41 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.74 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|