C29H45N3O3 — CID 133073833
(4S)-1'-(cyclohexylmethyl)-4-propan-2-ylspiro[2-oxa-5,12-diazabicyclo[12.4.0]octadeca-1(18),14,16-triene-7,4'-piperidine]-6,13-dione (PubChem CID 133073833) has the molecular formula C29H45N3O3 and a molecular weight of 483.70 g/mol. Its IUPAC name is (4S)-1'-(cyclohexylmethyl)-4-propan-2-ylspiro[2-oxa-5,12-diazabicyclo[12.4.0]octadeca-1(18),14,16-triene-7,4'-piperidine]-6,13-dione.
| Compound Name | (4S)-1'-(cyclohexylmethyl)-4-propan-2-ylspiro[2-oxa-5,12-diazabicyclo[12.4.0]octadeca-1(18),14,16-triene-7,4'-piperidine]-6,13-dione |
|---|---|
| PubChem CID | 133073833 |
| Molecular Formula | C29H45N3O3 |
| Molecular Weight | 483.70 g/mol |
| Exact Mass | 483.35 |
| IUPAC Name | (4S)-1'-(cyclohexylmethyl)-4-propan-2-ylspiro[2-oxa-5,12-diazabicyclo[12.4.0]octadeca-1(18),14,16-triene-7,4'-piperidine]-6,13-dione |
| SMILES | CC(C)[C@H]1COc2ccccc2C(=O)NCCCCC2(CCN(CC3CCCCC3)CC2)C(=O)N1 |
| InChI | InChI=1S/C29H45N3O3/c1-22(2)25-21-35-26-13-7-6-12-24(26)27(33)30-17-9-8-14-29(28(34)31-25)15-18-32(19-16-29)20-23-10-4-3-5-11-23/h6-7,12-13,22-23,25H,3-5,8-11,14-21H2,1-2H3,(H,30,33)(H,31,34)/t25-/m1/s1 |
| InChIKey | LHJXEWPJISIHLS-RUZDIDTESA-N |
| XLogP | 4.78 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.70 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |