C28H33N3O3S — CID 155989411
(9E)-1'-[2-(2,3-dihydro-1,4-benzothiazin-4-yl)-2-oxoethyl]spiro[2-oxa-5-azabicyclo[10.4.0]hexadeca-1(16),9,12,14-tetraene-7,4'-piperidine]-6-one (PubChem CID 155989411) has the molecular formula C28H33N3O3S and a molecular weight of 491.66 g/mol. Its IUPAC name is (9E)-1'-[2-(2,3-dihydro-1,4-benzothiazin-4-yl)-2-oxoethyl]spiro[2-oxa-5-azabicyclo[10.4.0]hexadeca-1(16),9,12,14-tetraene-7,4'-piperidine]-6-one.
| Compound Name | (9E)-1'-[2-(2,3-dihydro-1,4-benzothiazin-4-yl)-2-oxoethyl]spiro[2-oxa-5-azabicyclo[10.4.0]hexadeca-1(16),9,12,14-tetraene-7,4'-piperidine]-6-one |
|---|---|
| PubChem CID | 155989411 |
| Molecular Formula | C28H33N3O3S |
| Molecular Weight | 491.66 g/mol |
| Exact Mass | 491.22 |
| IUPAC Name | (9E)-1'-[2-(2,3-dihydro-1,4-benzothiazin-4-yl)-2-oxoethyl]spiro[2-oxa-5-azabicyclo[10.4.0]hexadeca-1(16),9,12,14-tetraene-7,4'-piperidine]-6-one |
| SMILES | O=C(CN1CCC2(C/C=C/Cc3ccccc3OCCNC2=O)CC1)N1CCSc2ccccc21 |
| InChI | InChI=1S/C28H33N3O3S/c32-26(31-18-20-35-25-11-4-2-9-23(25)31)21-30-16-13-28(14-17-30)12-6-5-8-22-7-1-3-10-24(22)34-19-15-29-27(28)33/h1-7,9-11H,8,12-21H2,(H,29,33)/b6-5+ |
| InChIKey | SRUUQUCIAUODOB-AATRIKPKSA-N |
| XLogP | 3.91 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.66 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|