C22H30N2O5 — CID 166415788
(4Z)-12-(2-methoxyethyl)spiro[2-oxa-9,12-diazabicyclo[12.4.0]octadeca-1(18),4,14,16-tetraene-7,4'-oxane]-8,13-dione (PubChem CID 166415788) has the molecular formula C22H30N2O5 and a molecular weight of 402.49 g/mol. Its IUPAC name is (4Z)-12-(2-methoxyethyl)spiro[2-oxa-9,12-diazabicyclo[12.4.0]octadeca-1(18),4,14,16-tetraene-7,4'-oxane]-8,13-dione.
| Compound Name | (4Z)-12-(2-methoxyethyl)spiro[2-oxa-9,12-diazabicyclo[12.4.0]octadeca-1(18),4,14,16-tetraene-7,4'-oxane]-8,13-dione |
|---|---|
| PubChem CID | 166415788 |
| Molecular Formula | C22H30N2O5 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | (4Z)-12-(2-methoxyethyl)spiro[2-oxa-9,12-diazabicyclo[12.4.0]octadeca-1(18),4,14,16-tetraene-7,4'-oxane]-8,13-dione |
| SMILES | COCCN1CCNC(=O)C2(C/C=C\COc3ccccc3C1=O)CCOCC2 |
| InChI | InChI=1S/C22H30N2O5/c1-27-17-13-24-12-11-23-21(26)22(9-15-28-16-10-22)8-4-5-14-29-19-7-3-2-6-18(19)20(24)25/h2-7H,8-17H2,1H3,(H,23,26)/b5-4- |
| InChIKey | FLFJVBZLVYYITI-PLNGDYQASA-N |
| XLogP | 2.03 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|