C24H30N2O7 — CID 100985413
2,5,8,19,22-pentaoxa-16,25-diazatricyclo[25.4.0.09,14]hentriaconta-1(31),9,11,13,27,29-hexaene-15,26-dione (PubChem CID 100985413) has the molecular formula C24H30N2O7 and a molecular weight of 458.51 g/mol. Its IUPAC name is 2,5,8,19,22-pentaoxa-16,25-diazatricyclo[25.4.0.09,14]hentriaconta-1(31),9,11,13,27,29-hexaene-15,26-dione.
| Compound Name | 2,5,8,19,22-pentaoxa-16,25-diazatricyclo[25.4.0.09,14]hentriaconta-1(31),9,11,13,27,29-hexaene-15,26-dione |
|---|---|
| PubChem CID | 100985413 |
| Molecular Formula | C24H30N2O7 |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | 2,5,8,19,22-pentaoxa-16,25-diazatricyclo[25.4.0.09,14]hentriaconta-1(31),9,11,13,27,29-hexaene-15,26-dione |
| SMILES | O=C1NCCOCCOCCNC(=O)c2ccccc2OCCOCCOc2ccccc21 |
| InChI | InChI=1S/C24H30N2O7/c27-23-19-5-1-3-7-21(19)32-17-15-31-16-18-33-22-8-4-2-6-20(22)24(28)26-10-12-30-14-13-29-11-9-25-23/h1-8H,9-18H2,(H,25,27)(H,26,28) |
| InChIKey | WRONBKKIFLEULH-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 104.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |