C16H23N3O6 — CID 86077985
22-amino-2,8,11,17-tetraoxa-5,14-diazabicyclo[16.3.1]docosa-1(22),18,20-triene-4,15-dione (PubChem CID 86077985) has the molecular formula C16H23N3O6 and a molecular weight of 353.38 g/mol. Its IUPAC name is 22-amino-2,8,11,17-tetraoxa-5,14-diazabicyclo[16.3.1]docosa-1(22),18,20-triene-4,15-dione.
| Compound Name | 22-amino-2,8,11,17-tetraoxa-5,14-diazabicyclo[16.3.1]docosa-1(22),18,20-triene-4,15-dione |
|---|---|
| PubChem CID | 86077985 |
| Molecular Formula | C16H23N3O6 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 22-amino-2,8,11,17-tetraoxa-5,14-diazabicyclo[16.3.1]docosa-1(22),18,20-triene-4,15-dione |
| SMILES | Nc1c2cccc1OCC(=O)NCCOCCOCCNC(=O)CO2 |
| InChI | InChI=1S/C16H23N3O6/c17-16-12-2-1-3-13(16)25-11-15(21)19-5-7-23-9-8-22-6-4-18-14(20)10-24-12/h1-3H,4-11,17H2,(H,18,20)(H,19,21) |
| InChIKey | DZCQNZJNKFBCNN-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 121.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|