C32H34N2O7 — CID 132537273
12,18,21,24,30-pentaoxa-15,27-diazapentacyclo[29.8.0.02,11.03,8.034,39]nonatriaconta-1(31),2(11),3,5,7,9,32,34,36,38-decaene-14,28-dione (PubChem CID 132537273) has the molecular formula C32H34N2O7 and a molecular weight of 558.63 g/mol. Its IUPAC name is 12,18,21,24,30-pentaoxa-15,27-diazapentacyclo[29.8.0.02,11.03,8.034,39]nonatriaconta-1(31),2(11),3,5,7,9,32,34,36,38-decaene-14,28-dione.
| Compound Name | 12,18,21,24,30-pentaoxa-15,27-diazapentacyclo[29.8.0.02,11.03,8.034,39]nonatriaconta-1(31),2(11),3,5,7,9,32,34,36,38-decaene-14,28-dione |
|---|---|
| PubChem CID | 132537273 |
| Molecular Formula | C32H34N2O7 |
| Molecular Weight | 558.63 g/mol |
| Exact Mass | 558.24 |
| IUPAC Name | 12,18,21,24,30-pentaoxa-15,27-diazapentacyclo[29.8.0.02,11.03,8.034,39]nonatriaconta-1(31),2(11),3,5,7,9,32,34,36,38-decaene-14,28-dione |
| SMILES | O=C1COc2ccc3ccccc3c2-c2c(ccc3ccccc23)OCC(=O)NCCOCCOCCOCCN1 |
| InChI | InChI=1S/C32H34N2O7/c35-29-21-40-27-11-9-23-5-1-3-7-25(23)31(27)32-26-8-4-2-6-24(26)10-12-28(32)41-22-30(36)34-14-16-38-18-20-39-19-17-37-15-13-33-29/h1-12H,13-22H2,(H,33,35)(H,34,36) |
| InChIKey | YYJHLNWWRQKCHT-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 104.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.63 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |