C34H36N2O8 — CID 15605850
4-methylidene-2,6,17,23,26,32-hexaoxa-20,29-diazapentacyclo[31.8.0.07,16.09,14.035,40]hentetraconta-1(41),7,9,11,13,15,33,35,37,39-decaene-19,30-dione (PubChem CID 15605850) has the molecular formula C34H36N2O8 and a molecular weight of 600.67 g/mol. Its IUPAC name is 4-methylidene-2,6,17,23,26,32-hexaoxa-20,29-diazapentacyclo[31.8.0.07,16.09,14.035,40]hentetraconta-1(41),7,9,11,13,15,33,35,37,39-decaene-19,30-dione.
| Compound Name | 4-methylidene-2,6,17,23,26,32-hexaoxa-20,29-diazapentacyclo[31.8.0.07,16.09,14.035,40]hentetraconta-1(41),7,9,11,13,15,33,35,37,39-decaene-19,30-dione |
|---|---|
| PubChem CID | 15605850 |
| Molecular Formula | C34H36N2O8 |
| Molecular Weight | 600.67 g/mol |
| Exact Mass | 600.25 |
| IUPAC Name | 4-methylidene-2,6,17,23,26,32-hexaoxa-20,29-diazapentacyclo[31.8.0.07,16.09,14.035,40]hentetraconta-1(41),7,9,11,13,15,33,35,37,39-decaene-19,30-dione |
| SMILES | C=C1COc2cc3ccccc3cc2OCC(=O)NCCOCCOCCNC(=O)COc2cc3ccccc3cc2OC1 |
| InChI | InChI=1S/C34H36N2O8/c1-24-20-41-29-16-25-6-2-4-8-27(25)18-31(29)43-22-33(37)35-10-12-39-14-15-40-13-11-36-34(38)23-44-32-19-28-9-5-3-7-26(28)17-30(32)42-21-24/h2-9,16-19H,1,10-15,20-23H2,(H,35,37)(H,36,38) |
| InChIKey | QNAIGOPGGRKGKA-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 113.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.67 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|