C22H27N3O5 — CID 15209318
2,5,8-trioxa-16,19,22-triazatricyclo[22.4.0.09,14]octacosa-1(28),9,11,13,24,26-hexaene-15,23-dione (PubChem CID 15209318) has the molecular formula C22H27N3O5 and a molecular weight of 413.47 g/mol. Its IUPAC name is 2,5,8-trioxa-16,19,22-triazatricyclo[22.4.0.09,14]octacosa-1(28),9,11,13,24,26-hexaene-15,23-dione.
| Compound Name | 2,5,8-trioxa-16,19,22-triazatricyclo[22.4.0.09,14]octacosa-1(28),9,11,13,24,26-hexaene-15,23-dione |
|---|---|
| PubChem CID | 15209318 |
| Molecular Formula | C22H27N3O5 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | 2,5,8-trioxa-16,19,22-triazatricyclo[22.4.0.09,14]octacosa-1(28),9,11,13,24,26-hexaene-15,23-dione |
| SMILES | O=C1NCCNCCNC(=O)c2ccccc2OCCOCCOc2ccccc21 |
| InChI | InChI=1S/C22H27N3O5/c26-21-17-5-1-3-7-19(17)29-15-13-28-14-16-30-20-8-4-2-6-18(20)22(27)25-12-10-23-9-11-24-21/h1-8,23H,9-16H2,(H,24,26)(H,25,27) |
| InChIKey | PNJZGLRTIWKXSO-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |