C14H19N3O4 — CID 100915374
2,14-dioxa-5,8,11-triazabicyclo[13.3.1]nonadeca-1(19),15,17-triene-4,12-dione (PubChem CID 100915374) has the molecular formula C14H19N3O4 and a molecular weight of 293.32 g/mol. Its IUPAC name is 2,14-dioxa-5,8,11-triazabicyclo[13.3.1]nonadeca-1(19),15,17-triene-4,12-dione.
| Compound Name | 2,14-dioxa-5,8,11-triazabicyclo[13.3.1]nonadeca-1(19),15,17-triene-4,12-dione |
|---|---|
| PubChem CID | 100915374 |
| Molecular Formula | C14H19N3O4 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 2,14-dioxa-5,8,11-triazabicyclo[13.3.1]nonadeca-1(19),15,17-triene-4,12-dione |
| SMILES | O=C1COc2cccc(c2)OCC(=O)NCCNCCN1 |
| InChI | InChI=1S/C14H19N3O4/c18-13-9-20-11-2-1-3-12(8-11)21-10-14(19)17-7-5-15-4-6-16-13/h1-3,8,15H,4-7,9-10H2,(H,16,18)(H,17,19) |
| InChIKey | DXURAQZAUINJTQ-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |