C26H44N8 — CID 101443368
2,5,9,12,18,21,25,28-octazatricyclo[27.3.1.113,17]tetratriaconta-1(33),13(34),14,16,29,31-hexaene (PubChem CID 101443368) has the molecular formula C26H44N8 and a molecular weight of 468.69 g/mol. Its IUPAC name is 2,5,9,12,18,21,25,28-octazatricyclo[27.3.1.113,17]tetratriaconta-1(33),13(34),14,16,29,31-hexaene.
| Compound Name | 2,5,9,12,18,21,25,28-octazatricyclo[27.3.1.113,17]tetratriaconta-1(33),13(34),14,16,29,31-hexaene |
|---|---|
| PubChem CID | 101443368 |
| Molecular Formula | C26H44N8 |
| Molecular Weight | 468.69 g/mol |
| Exact Mass | 468.37 |
| IUPAC Name | 2,5,9,12,18,21,25,28-octazatricyclo[27.3.1.113,17]tetratriaconta-1(33),13(34),14,16,29,31-hexaene |
| SMILES | c1cc2cc(c1)NCCNCCCNCCNc1cccc(c1)NCCNCCCNCCN2 |
| InChI | InChI=1S/C26H44N8/c1-5-23-21-24(6-1)32-18-14-28-10-4-12-30-16-20-34-26-8-2-7-25(22-26)33-19-15-29-11-3-9-27-13-17-31-23/h1-2,5-8,21-22,27-34H,3-4,9-20H2 |
| InChIKey | ORKSCYYKMRSGPL-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 96.24 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.69 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |