C13H23N5 — CID 86069022
2,6,9,13,16-pentazabicyclo[12.3.1]octadeca-1(18),14,16-triene (PubChem CID 86069022) has the molecular formula C13H23N5 and a molecular weight of 249.36 g/mol. Its IUPAC name is 2,6,9,13,16-pentazabicyclo[12.3.1]octadeca-1(18),14,16-triene.
| Compound Name | 2,6,9,13,16-pentazabicyclo[12.3.1]octadeca-1(18),14,16-triene |
|---|---|
| PubChem CID | 86069022 |
| Molecular Formula | C13H23N5 |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.20 |
| IUPAC Name | 2,6,9,13,16-pentazabicyclo[12.3.1]octadeca-1(18),14,16-triene |
| SMILES | c1ncc2cc1NCCCNCCNCCCN2 |
| InChI | InChI=1S/C13H23N5/c1-3-14-7-8-15-4-2-6-18-13-9-12(17-5-1)10-16-11-13/h9-11,14-15,17-18H,1-8H2 |
| InChIKey | PESGXRVKSCUMPX-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 61.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |